What is the correct Iupac name for ethyl propyl ketone?
3-Hexanone
3-Hexanone (ethyl propyl ketone) is an organic compound with the formula C6H12O….3-Hexanone.
| Names | |
|---|---|
| Preferred IUPAC name Hexan-3-one | |
| Other names Ethyl propyl ketone | |
| Identifiers | |
| CAS Number | 589-38-8 |
What is the systematic Iupac name of sec butyl alcohol?
2-methyl-2-butanol.
What is the common name of hexanone?
2-Hexanone is also known as methyl n-butyl ketone, MBK, or propyl acetone. It is a clear, colorless liquid with a sharp odor.
Which of the following is the Iupac name of butyl alcohol?
| IUPAC Name | butan-1-ol |
|---|---|
| Alternative Names | 1-butanol n-butanol butanol Butan-1-ol Butyl alcohol n-butyl alcohol 1-hydroxybutane Propylcarbinol |
| Molecular Formula | C4H10O |
| Molar Mass | 74.123 g/mol |
| InChI | InChI=1S/C4H10O/c1-2-3-4-5/h5H,2-4H2,1H3 |
What is the IUPAC name of benzophenone?
diphenylmethanone
| IUPAC Name | diphenylmethanone |
|---|---|
| Alternative Names | BENZOPHENONE diphenylmethanone Diphenyl ketone |
| Molecular Formula | C13H10O |
| Molar Mass | 182.222 g/mol |
| InChI | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
What is the IUPAC name of ch3och2ch3?
methoxyethane
So, according to the above-mentioned points, the IUPAC name of the compound will be methoxyethane.
Is SEC-butyl a Iupac?
According to IUPAC nomenclature, “isobutyl”, “sec-butyl”, and “tert-butyl” used to be allowed retained names. Butyl is the largest substituent for which trivial names are commonly used for all isomers.
What is Iupac name of secondary butyl?
Sec-butyl chloride which is also known as secondary butyl chloride. Its IUPAC name is 2-Butyl chloride.
What is the formula of hexanone?
C6H12O
3-Hexanone/Formula
3-Hexanone (ethyl propyl ketone) is an organic compound with the formula C6H12O. It is a ketone used as a solvent and as a chemical intermediate.
Is SEC butyl a Iupac?
What is the IUPAC name of tert-butyl?
Tert-Butanol
| PubChem CID | 6386 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C4H10O or (CH3)3COH |
| Synonyms | tert-Butanol tert-Butyl alcohol 2-Methyl-2-propanol 2-Methylpropan-2-ol 75-65-0 More… |