Does N2O6 exist?
Structure of Nitrooxy nitrate (N2O6)
What type of formula is N2O6?
Identification of Nitrooxy nitrate Chemical Compound
| Chemical Formula | N2O6 |
|---|---|
| Molecular Weight | 124.0098 g/mol |
| IUPAC Name | nitrooxy nitrate |
| SMILES String | [O-][N+](=O)OO[N+]([O-])=O |
| InChI | InChI=1S/N2O6/c3-1(4)7-8-2(5)6 |
What is the chemical name of n4o2?
N-diazonitramide
N-Diazonitramide
| PubChem CID | 22902439 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | N4O2 |
| Synonyms | N-diazonitramide |
| Molecular Weight | 88.03 |
What is the name for n2br6?
Nitrosyl bromide
| PubChem CID | 123304 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | NOBr or BrNO |
| Synonyms | Nitrosyl bromide Nitrosyl bromide ((NO)Br) 13444-87-6 Nitrosylbromid DTXSID90158701 More… |
| Molecular Weight | 109.91 |
How do you make dinitrogen pentoxide?
Dinitrogen Pentoxide is the anhydride form of nitric acid, can be made as white crystals, by carefully dehydrating nitric acid with diphosphorus pentoxide or by oxidizing nitrogen dioxide with ozone. It is unstable compound decompose spontaneously at room temperature into nitrogen dioxide and oxygen.
What is the structure of h3po5?
Peroxyphosphoric acid
| PubChem CID | 6326786 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | H3O5P |
| Synonyms | peroxyphosphoric acid phosphoroperoxoic acid CHEBI:29282 Peroxymonophosphate Peroxophosphoric acid More… |
| Molecular Weight | 113.99 |
What is the empirical formula of n4o2?
N4O2
nitryl azide/Formula
How do you calculate dinitrogen pentoxide?
N2O5
Dinitrogen pentoxide/Formula