How do you make benzocaine from P-aminobenzoic acid?
Synthesis of benzocaine: Into a 100 ml flask, mix 1.25 g of p-aminobenzoic acid hydrochloride, 10 ml of EtOH, and 0.5 ml H2SO4 (conc.). Heat the mixture at reflux for 2 h. After cooling the mixture, neutralize with an aqueous sodium carbonate solution (10%).
How do you make benzocaine?
Benzocaine can be prepared by esterification using 4-aminobenzoic acid and ethanol. It can also be prepared by reduction of ethyl 4-nitrobenzoate to the amine. In industrial practice, the reducing agent is usually iron and water in the presence of a little acid.
How do you calculate theoretical yield of benzocaine?
Calculations: Theoretical yield= 0.126g 4-aminobenzoic acid x 165.192g benzocaine / 137.138g 4- aminobenzoic acid =0.152 g benzocaine Percent yield= 0.035 g product / 0.152 g theoretical x 100 = 23% Recorded melting point range: 92 to 94 °C ℃ Conclusion: The purpose of this experiment was to synthesize benzene in order …
What does PABA mean?
Para-Aminobenzoic Acid (Paba)
Is benzocaine an acid or base?
Benzocaine is a benzoate ester having 4-aminobenzoic acid as the acid component and ethanol as the alcohol component.
Is it illegal to buy benzocaine?
Although benzocaine and lidocaine are legal substances, it is illegal to supply these chemicals to the underground drugs trade. But drug dealers like to use it in powder form to dilute pure class A and class B drugs such as naphyrone and mephedrone because of the numbing sensation it offers when placed on the skin.
What is the empirical formula for Benzocaine?
Identification of Benzocaine Chemical Compound
| Chemical Formula | C9H11NO2 |
|---|---|
| IUPAC Name | ethyl 4-aminobenzoate |
| SMILES String | CCOC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| InChIKey | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
What is the molecular weight of benzocaine?
165.19 g/mol
Benzocaine/Molar mass
Is 4-nitrobenzoic acid soluble in water?
4-Nitrobenzoic acid
| Names | |
|---|---|
| Melting point | 237 °C (459 °F; 510 K) |
| Boiling point | Sublimes |
| Solubility in water | <0.1 g/100 mL at 26 °C |
| Acidity (pKa) | 3.41 (in water), 9.1 (in DMSO) |
What is the melting point of 4-nitrobenzoic acid?
458.6°F (237°C)
4-Nitrobenzoic acid/Melting point
What kind of acid is 4-Nitrobenzoic acid?
It derives from a benzoic acid. It is a conjugate acid of a 4-nitrobenzoate. P-nitrobenzoic acid appears as odorless pale yellow crystals. (NTP, 1992) 4-nitrobenzoic acid
What kind of ester is benzocaine made of?
Benzocaine is an ester, a compound made from the organic acid PABA ( para-aminobenzoic acid) and ethanol. The process in which this ester is created is known as Fischer esterification. ethyl 4-aminobenzoate
How is benzocaine used as a surface anaesthetic?
Benzocaine is a benzoate ester having 4-aminobenzoic acid as the acid component and ethanol as the alcohol component. A surface anaesthetic, it is used to suppress the gag reflex, and as a lubricant and topical anaesthetic on the larynx, mouth, nasal cavity, respiratory tract, oesophagus, rectum, urinary tract, and vagina.
How does benzocaine affect the conduction of nerve impulses?
Depolarization of the neuronal membrane is inhibited, thereby blocking the initiation and conduction of nerve impulses. Benzocaine is a benzoate ester having 4-aminobenzoic acid as the acid component and ethanol as the alcohol component.