What is the molecular formula of dimethyl ketone?

What is the molecular formula of dimethyl ketone?

C3H6O
Acetone/Formula

Are acetone and dimethyl ketone same?

Acetone is a manufactured chemical that is also found naturally in the environment. It is a colorless liquid with a distinct smell and taste. It evaporates easily, is flammable, and dissolves in water. It is also called dimethyl ketone, 2-propanone, and beta-ketopropane.

What is the Iupac name of CH3 CO CH3?

So IUPAC name of the compound is Propanone.

What is the pH of MEK?

5.5
Formula: C2H5COCH3 CAS No.: 78-93-3 pH: 5.5 (300 g/l, H2O, 20°C) Solubility: 292 g/l (20°C) Melting Point: -86°C Molar Mass: 72.11 g/mol Boiling Point: 79.6°C (1013 hPa) Vapor Pressure: 105 hPa (20°C) Flash Point: -1°C Refractive Index: 1.3814 (15°C) Explosion Limit: …

What is the Iupac name for dimethyl ketone?

-propanone propanone

IUPAC Name propan-2-one
Alternative Names 2-propanone propanone Dimethyl ketone
Molecular Formula C3H6O
Molar Mass 58.08 g/mol
InChI InChI=1S/C3H6O/c1-3(2)4/h1-2H3

What is Ketone formula?

License. In chemistry, a ketone is a functional group with the structure R2C=O, where R can be a variety of carbon-containing substituents. Ketones contain a carbonyl group (a carbon-oxygen double bond). The simplest ketone is acetone (R = R’ = methyl), with the formula CH3C(O)CH3.

Is formaldehyde a ketone?

The carbon atom of this group has two remaining bonds that may be occupied by hydrogen or alkyl or aryl substituents. If at least one of these substituents is hydrogen, the compound is an aldehyde. If neither is hydrogen, the compound is a ketone. For example, H2C=O is methanal, more commonly called formaldehyde.

What is the functional group of ch3 CO ch3?

Ketone
The name of the functional group present in CH3COCH3 is Ketone. The name of the compound is Propanone.

Which is the correct formula for preparing a ketone?

Preparation of ketones: The general formula for a ketone is R (C=O)R’, where R and R’ can be alkyl or aryl groups. They are classified into two categories by their substituents: symmetrical ketones (when two identical groups are attached to the carbonyl group) and asymmetrical ketones (when two different groups are appended to the carbonyl group).

What kind of liquid is dimethyl ketone?

Dimethyl Ketone. OVERVIEW. Dimethyl ketone (DYE-meth-el KEY-tone) is a clear, colorless, highly volatile and highly flammable liquid with a characteristic sweet odor and taste. The compound is almost universally known in chemistry laboratories and industrial applications by its common name of acetone.

Which is the chemical formula for acetone methyl ketone?

The IUPAC name of Acetone is 2 -propanone with a condensed chemical formula C 3 H 6 O. Acetone is made up of three carbon atoms, six hydrogen atoms, and one oxygen atom. It is considered a ketone since there is a carbonyl group present in it. A methyl ketone that consists of propane bearing an oxo group at C – 2 carbon atom.

What is the structure of a ketone group?

A ketone is a functional group that consists of a carbonyl carbon (which is a carbon atom bound to an oxygen atom by a double bond) and two alkyl or aryl groups.