What is the structural formula for 2 Methyl 3 ethyl hexane?
3-Ethyl-2-methylhexane
| PubChem CID | 86067 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C9H20 |
| Synonyms | 3-Ethyl-2-methylhexane Hexane, 3-ethyl-2-methyl- 3-ethyl-2-methyl-hexane 16789-46-1 2-Ethyl-3-methylhexane More… |
| Molecular Weight | 128.25 |
What is the structure of 4-Ethyl-2-Methylhexane?
Identification of 4-Ethyl-2-methylhexane Chemical Compound
| Chemical Formula | C9H20 |
|---|---|
| IUPAC Name | 4-ethyl-2-methylhexane |
| SMILES String | CCC(CC)CC(C)C |
| InChI | InChI=1S/C9H20/c1-5-9(6-2)7-8(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | KYCZJIBOPKRSOV-UHFFFAOYSA-N |
What is the proper structure for 3 ethyl 2 Methylpentane?
C8H18
3-ethyl-2-methylpentane
| Compound number: | MolPort-003-894-659 |
|---|---|
| IUPAC traditional: | 2-methyl-3-ethylpentane |
| SMILES: | CCC(CC)C(C)C |
| InChI key: | DUPUVYJQZSLSJB-UHFFFAOYSA-N |
| Molecular formula: | C8H18 |
What is the line formula for 4 ethyl 2 Methylhexane?
Formula of 4-Ethyl-2-methylhexane (C9H20)
What is the structure of 3 ethyl 5 Methylheptane?
3-Ethyl-5-methylheptane | C10H22 | ChemSpider.
What is the structure of 3 ethyl 2 methyl butane?
3-Ethyl-2-methylpentane | C8H18 – PubChem.
What is the molecular formula for 2-ethyl-1-hexene?
2-Ethyl-1-hexene PubChem CID 15404 Structure Find Similar Structures Chemical Safety Laboratory Chemical Safety Summary (LCSS Molecular Formula C8H16 Synonyms 2-ETHYL-1-HEXENE 1632-16-2 3-methylenehe
Which is a synonym for 3-ethyl 2-methylhexane?
Synonyms: 3-Ethyl-2-methylhexane. Hexane, 3-ethyl-2-methyl-. 3-ethyl-2-methyl-hexane. 16789-46-1. 2-Ethyl-3-methylhexane. More… Molecular Weight: 128.25 g/mol.
What kind of olefin is 3-methyleneheptane?
3-Methyleneheptane is an acyclic olefin. 3-Methyleneheptane belongs to the class of organic compounds known as acyclic olefins. These are olefins that do not contain a ring in their structure. Copyright © 1980, 1981-2018 Bio-Rad Laboratories, Inc.