What is the structure of 2 phenyl?
2-phenylpropan-2-ol is a tertiary alcohol that is isopropanol in which the hydrogen attached to the carbon bearing the hydroxy group has been replaced by a phenyl group. It has a role as a Mycoplasma genitalium metabolite and a human xenobiotic metabolite.
What is the condensed structure of pentene?
The compound CH3CH=CHCH2CH3, for example, has the double bond between the second and third carbon atoms. Its name is 2-pentene (not 3-pentene)….13.1: Alkenes- Structures and Names.
| IUPAC Name | 1-pentene |
|---|---|
| Molecular Formula | C5H10 |
| Condensed Structural Formula | CH2=CH(CH2)2CH3 |
| Melting Point (°C) | –138 |
| Boiling Point (°C) | 30 |
What is the structure of 1 phenyl?
Showing Compound 1-Phenyl-1-propanone (FDB010567)
| Record Information | |
|---|---|
| Chemical Formula | C9H10O |
| IUPAC name | |
| InChI Identifier | InChI=1S/C9H10O/c1-2-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChI Key | KRIOVPPHQSLHCZ-UHFFFAOYSA-N |
What is the structure of 3 phenyl pentane?
(1-Ethylpropyl)benzene
| PubChem CID | 14527 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C11H16 |
| Synonyms | (1-Ethylpropyl)benzene 3-PHENYLPENTANE 1196-58-3 pentan-3-ylbenzene Benzene, (1-ethylpropyl)- More… |
| Molecular Weight | 148.24 |
What is the structure of 1 phenyl 2 butene?
1-Phenyl-2-butene
| PubChem CID | 5356732 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C10H12 |
| Synonyms | 1-Phenyl-2-butene Benzene, 2-butenyl- 1-Phenylbutene-2 2-Butene, 1-phenyl- 4-Phenyl-2-butene More… |
| Molecular Weight | 132.20 |
What is the structural formula for 2-pentene?
C5H10
2-Pentene/Formula
What is the structural formula for 1 pentene?
1-Pentene/Formula
What is phenyl pentane?
3-amino-5-phenylpentane is a solid. This compound belongs to the phenylpropylamines. These are compounds containing a phenylpropylamine moiety, which consists of a phenyl group substituted at the third carbon by a propan-1-amine. 3-amino-5-phenylpentane targets the proteins cathepsin K and cathepsin L2.
What is resorcinol reagent?
Resorcinol is an analytical reagent for the qualitative determination of ketoses (Seliwanoff’s test). Resorcinol is the starting material for resorcinarene molecules and the initiating explosive lead styphnate. Resorcinol reacts with formaldehyde to form a thermoset resin which can form the basis of an aerogel.