What is the structure of 2-hexanone?
C6H12O
2-Hexanone/Formula
What is 2-hexanone found in?
2-Hexanone is found in many foods, some of which are nuts, cereals and cereal products, pepper (c. annuum), and cloves.
Which of the following compounds is 2-hexanone?
methyl n-butyl ketone
2-Hexanone is also known as methyl n-butyl ketone, MBK, or propyl acetone. It is a clear, colorless liquid with a sharp odor. It dissolves very easily in water, and can evaporate easily into the air as a vapor.
Is 2-hexanone a methyl ketone?
2-Hexanone (methyl butyl ketone, MBK) is a ketone used as a general solvent and in paints. It dissolves cellulose nitrate, vinyl polymers and copolymers, and natural and synthetic resins.
What intermolecular forces are present in 2-hexanone?
While both compounds demonstrate dispersion forces, 2-hexanone consists of hydrogen, carbon as well as an oxygen atom, producing a dipole moment due to the large gap in electronegativity, and hence this compound demonstrates a dipole-dipole attraction.
What is the molecular weight of 2-hexanone?
100.161 g/mol
| IUPAC Name | hexan-2-one |
|---|---|
| Molecular Formula | C6H12O |
| Molar Mass | 100.161 g/mol |
| InChI | InChI=1S/C6H12O/c1-3-4-5-6(2)7/h3-5H2,1-2H3 |
| InChI Key | QQZOPKMRPOGIEB-UHFFFAOYSA-N |
What is the structural formula of 2 Heptanone?
C7H14O
2-Heptanone/Formula
2-Heptanone, also known as methyl n-amyl ketone, or Heptan-2-one, is a ketone with the molecular formula C7H14O. It is a colorless, water-like liquid with a banana-like, fruity odor. 2-Heptanone has a neutral formal charge, and is only slightly soluble in water.
What does 2-hexanone smell like?
Colorless liquid with an acetone-like odor.
Is 2-hexanone water soluble?
2-Hexanone is also known as methyl n-butyl ketone, MBK, or propyl acetone. It is a clear, colorless liquid with a sharp odor. It dissolves very easily in water and can evaporate easily into the air as a vapor.
What is the structural formula of hexanone?
What intermolecular forces are present in 2-Heptanone?
The ketone 2-heptanone is a polar molecular compound with dipole-dipole attractions between the molecules. Pentanoic acid, like all carboxylic acids, has molecules mutually attracted by hydrogen bonds.
What is the boiling point of 2 hexanone?
262.4°F (128°C)
2-Hexanone/Boiling point