What is the formula of phthalic anhydride?
C8H4O3
Phthalic anhydride/Formula
What is the Iupac name of phthalic anhydride?
Phthalic anhydride
| Names | |
|---|---|
| Preferred IUPAC name 2-Benzofuran-1,3-dione | |
| Other names Isobenzofuran-1,3-dione Phthalic anhydride | |
| Identifiers | |
| CAS Number | 85-44-9 |
What is the Iupac name of phthalic acid?
| IUPAC Name | phthalic acid |
|---|---|
| Alternative Names | 1,2-benzenedicarboxylic acid benzene-1,2-dicarboxylic acid o-phthalic acid o-dicarboxybenzene o-benzenedicarboxylic acid ortho-phthalic acid |
| Molecular Formula | C8H6O4 |
| Molar Mass | 166.132 g/mol |
| InChI | InChI=1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12) |
How do you make phthalic acid solution?
Production. Phthalic acid is produced by the catalytic oxidation of naphthalene or ortho-xylene directly to phthalic anhydride and a subsequent hydrolysis of the anhydride. Phthalic acid was first obtained by French chemist Auguste Laurent in 1836 by oxidizing naphthalene tetrachloride.
What is use of phthalic anhydride?
Phthalic anhydride is an important chemical intermediate in the plastics industry from which are derived. numerous phthalate esters that function as plasticizers in synthetic resins. Phthalic anhydride itself is used. as a monomer for synthetic resins such as glyptal, the alkyd resins, and the polyester resins. (
How does ethanol react with ch3co 2o?
Alcohols and amines are readily acetylated. For example, the reaction of acetic anhydride with ethanol yields ethyl acetate: (CH3CO)2O + CH3CH2OH → CH3CO2CH2CH3 + CH3COOH. Often a base such as pyridine is added to function as catalyst.
What is the melting point of phthalic anhydride?
267.8°F (131°C)
Phthalic anhydride/Melting point
What is the Colour and shape of phthalic anhydride?
Phthalic anhydride appears as a colorless to white lustrous solid in the form of needles with a mild distinctive odor.